C13H18Cl2N2O — CID 141089706
N-(3-aminopropyl)-3-(2,3-dichlorophenyl)butanamide (PubChem CID 141089706) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(2,3-dichlorophenyl)butanamide.
| Compound Name | N-(3-aminopropyl)-3-(2,3-dichlorophenyl)butanamide |
|---|---|
| PubChem CID | 141089706 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-(3-aminopropyl)-3-(2,3-dichlorophenyl)butanamide |
| SMILES | CC(CC(=O)NCCCN)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl2N2O/c1-9(8-12(18)17-7-3-6-16)10-4-2-5-11(14)13(10)15/h2,4-5,9H,3,6-8,16H2,1H3,(H,17,18) |
| InChIKey | VEUHEQFIXQDQRY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|