C10H14N2O — CID 141090157
1-(2,3,3a,4-tetrahydrobenzimidazol-1-yl)propan-1-one (PubChem CID 141090157) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-(2,3,3a,4-tetrahydrobenzimidazol-1-yl)propan-1-one.
| Compound Name | 1-(2,3,3a,4-tetrahydrobenzimidazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 141090157 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-(2,3,3a,4-tetrahydrobenzimidazol-1-yl)propan-1-one |
| SMILES | CCC(=O)N1CNC2CC=CC=C21 |
| InChI | InChI=1S/C10H14N2O/c1-2-10(13)12-7-11-8-5-3-4-6-9(8)12/h3-4,6,8,11H,2,5,7H2,1H3 |
| InChIKey | VNPPEMNNVCKDFU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |