About 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride
2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride (PubChem CID 141091406) has the molecular formula C14H18Cl2N4O2
and a molecular weight of 345.23 g/mol. Its IUPAC name is 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride |
| PubChem CID | 141091406 |
| Molecular Formula | C14H18Cl2N4O2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride |
| SMILES | CCCc1c(C(N)=O)cc(-c2cn[nH]c2)cc1C(N)=O.Cl.Cl |
| InChI | InChI=1S/C14H16N4O2.2ClH/c1-2-3-10-11(13(15)19)4-8(5-12(10)14(16)20)9-6-17-18-7-9;;/h4-7H,2-3H2,1H3,(H2,15,19)(H2,16,20)(H,17,18);2*1H |
| InChIKey | IUZGBIGWEMBOKS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride?
The IUPAC name of 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride (CID 141091406) is 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride.
What is the SMILES notation for 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride?
The canonical SMILES for 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride is CCCc1c(C(N)=O)cc(-c2cn[nH]c2)cc1C(N)=O.Cl.Cl.
What is the InChIKey of 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride?
The InChIKey is IUZGBIGWEMBOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2.2ClH/c1-2-3-10-11(13(15)19)4-8(5-12(10)14(16)20)9-6-17-18-7-9;;/h4-7H,2-3H2,1H3,(H2,15,19)(H2,16,20)(H,17,18);2*1H.
What are the key properties of 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride?
2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride has a molecular weight of 345.23 g/mol, XLogP of 2.07, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxamide;dihydrochloride is sourced from PubChem (CID 141091406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).