8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid

C11H16O6 — CID 141092651

IUPAC8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid
SMILESO=C(O)CCCCCCC(=O)OC1OC2OC12
InChIInChI=1S/C11H16O6/c12-7(13)5-3-1-2-4-6-8(14)15-10-9-11(16-9)17-10/h9-11H,1-6H2,(H,12,13)
InChIKeyVBUCTJMWBNSQLS-UHFFFAOYSA-N
MW244.24 g/mol
LogP1.04
Rot. Bonds8

About 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid

8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid (PubChem CID 141092651) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid.

Molecular Properties

Compound Name8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid
PubChem CID141092651
Molecular FormulaC11H16O6
Molecular Weight244.24 g/mol
Exact Mass244.09
IUPAC Name8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid
SMILESO=C(O)CCCCCCC(=O)OC1OC2OC12
InChIInChI=1S/C11H16O6/c12-7(13)5-3-1-2-4-6-8(14)15-10-9-11(16-9)17-10/h9-11H,1-6H2,(H,12,13)
InChIKeyVBUCTJMWBNSQLS-UHFFFAOYSA-N
XLogP1.04
TPSA85.36 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.24
LogP ≤ 51.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid?
The IUPAC name of 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid (CID 141092651) is 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid.
What is the SMILES notation for 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid?
The canonical SMILES for 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid is O=C(O)CCCCCCC(=O)OC1OC2OC12.
What is the InChIKey of 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid?
The InChIKey is VBUCTJMWBNSQLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O6/c12-7(13)5-3-1-2-4-6-8(14)15-10-9-11(16-9)17-10/h9-11H,1-6H2,(H,12,13).
What are the key properties of 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid?
8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid has a molecular weight of 244.24 g/mol, XLogP of 1.04, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,5-dioxabicyclo[2.1.0]pentan-3-yloxy)-8-oxooctanoic acid is sourced from PubChem (CID 141092651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).