C8H17N3O3 — CID 141092799
2-(2-aminoethyl)-4-(2-aminoethylamino)-4-oxobutanoic acid (PubChem CID 141092799) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4-(2-aminoethylamino)-4-oxobutanoic acid.
| Compound Name | 2-(2-aminoethyl)-4-(2-aminoethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141092799 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-(2-aminoethyl)-4-(2-aminoethylamino)-4-oxobutanoic acid |
| SMILES | NCCNC(=O)CC(CCN)C(=O)O |
| InChI | InChI=1S/C8H17N3O3/c9-2-1-6(8(13)14)5-7(12)11-4-3-10/h6H,1-5,9-10H2,(H,11,12)(H,13,14) |
| InChIKey | NGVCFZNZLAJFGC-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |