C13H24N2O5 — CID 123913806
6-amino-2-[2-(4-carboxybutanoylamino)ethyl]hexanoic acid (PubChem CID 123913806) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is 6-amino-2-[2-(4-carboxybutanoylamino)ethyl]hexanoic acid.
| Compound Name | 6-amino-2-[2-(4-carboxybutanoylamino)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 123913806 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 6-amino-2-[2-(4-carboxybutanoylamino)ethyl]hexanoic acid |
| SMILES | NCCCCC(CCNC(=O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H24N2O5/c14-8-2-1-4-10(13(19)20)7-9-15-11(16)5-3-6-12(17)18/h10H,1-9,14H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | YVPAQRMZXMJPAP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|