C34H61N3O8 — CID 158040348
12-amino-2-[4-(3-carboxypropanoylamino)butyl]-8-methyl-5-[4-(nonanoylamino)butyl]-4,7-dioxododecanoic acid (PubChem CID 158040348) has the molecular formula C34H61N3O8 and a molecular weight of 639.88 g/mol. Its IUPAC name is 12-amino-2-[4-(3-carboxypropanoylamino)butyl]-8-methyl-5-[4-(nonanoylamino)butyl]-4,7-dioxododecanoic acid.
| Compound Name | 12-amino-2-[4-(3-carboxypropanoylamino)butyl]-8-methyl-5-[4-(nonanoylamino)butyl]-4,7-dioxododecanoic acid |
|---|---|
| PubChem CID | 158040348 |
| Molecular Formula | C34H61N3O8 |
| Molecular Weight | 639.88 g/mol |
| Exact Mass | 639.45 |
| IUPAC Name | 12-amino-2-[4-(3-carboxypropanoylamino)butyl]-8-methyl-5-[4-(nonanoylamino)butyl]-4,7-dioxododecanoic acid |
| SMILES | CCCCCCCCC(=O)NCCCCC(CC(=O)C(C)CCCCN)C(=O)CC(CCCCNC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C34H61N3O8/c1-3-4-5-6-7-8-18-31(40)36-22-13-10-16-27(24-29(38)26(2)15-9-12-21-35)30(39)25-28(34(44)45)17-11-14-23-37-32(41)19-20-33(42)43/h26-28H,3-25,35H2,1-2H3,(H,36,40)(H,37,41)(H,42,43)(H,44,45) |
| InChIKey | PGWBETHYLWOKLS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 192.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|