C22H18O — CID 141094206
1-[(1E)-buta-1,3-dienyl]-4-(4-phenoxyphenyl)benzene (PubChem CID 141094206) has the molecular formula C22H18O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[(1E)-buta-1,3-dienyl]-4-(4-phenoxyphenyl)benzene.
| Compound Name | 1-[(1E)-buta-1,3-dienyl]-4-(4-phenoxyphenyl)benzene |
|---|---|
| PubChem CID | 141094206 |
| Molecular Formula | C22H18O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[(1E)-buta-1,3-dienyl]-4-(4-phenoxyphenyl)benzene |
| SMILES | C=C/C=C/c1ccc(-c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H18O/c1-2-3-7-18-10-12-19(13-11-18)20-14-16-22(17-15-20)23-21-8-5-4-6-9-21/h2-17H,1H2/b7-3+ |
| InChIKey | NGGKQCKGAXNCHE-XVNBXDOJSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|