About (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal
(1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal (PubChem CID 161398149) has the molecular formula C32H28O3
and a molecular weight of 460.57 g/mol. Its IUPAC name is (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal.
Molecular Properties
| Compound Name | (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal |
| PubChem CID | 161398149 |
| Molecular Formula | C32H28O3 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal |
| SMILES | C=C/C=C/O.O=C/C=C/c1ccc(-c2ccccc2)cc1.O=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12O.C13H10O.C4H6O/c16-12-4-5-13-8-10-15(11-9-13)14-6-2-1-3-7-14;14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-2-3-4-5/h1-12H;1-10H;2-5H,1H2/b5-4+;;4-3+ |
| InChIKey | VTWLKZASNOCXIU-WUBHIYFPSA-N |
| XLogP | 7.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal?
The IUPAC name of (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal (CID 161398149) is (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal.
What is the SMILES notation for (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal?
The canonical SMILES for (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal is C=C/C=C/O.O=C/C=C/c1ccc(-c2ccccc2)cc1.O=Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal?
The InChIKey is VTWLKZASNOCXIU-WUBHIYFPSA-N. The full InChI is InChI=1S/C15H12O.C13H10O.C4H6O/c16-12-4-5-13-8-10-15(11-9-13)14-6-2-1-3-7-14;14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-2-3-4-5/h1-12H;1-10H;2-5H,1H2/b5-4+;;4-3+.
What are the key properties of (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal?
(1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal has a molecular weight of 460.57 g/mol, XLogP of 7.98, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-buta-1,3-dien-1-ol;4-phenylbenzaldehyde;(E)-3-(4-phenylphenyl)prop-2-enal is sourced from PubChem (CID 161398149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).