C15H20BrNO2S2 — CID 141094622
N-(1-bromobutan-2-yl)-N-propyl-1-benzothiophene-2-sulfonamide (PubChem CID 141094622) has the molecular formula C15H20BrNO2S2 and a molecular weight of 390.37 g/mol. Its IUPAC name is N-(1-bromobutan-2-yl)-N-propyl-1-benzothiophene-2-sulfonamide.
| Compound Name | N-(1-bromobutan-2-yl)-N-propyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 141094622 |
| Molecular Formula | C15H20BrNO2S2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | N-(1-bromobutan-2-yl)-N-propyl-1-benzothiophene-2-sulfonamide |
| SMILES | CCCN(C(CC)CBr)S(=O)(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C15H20BrNO2S2/c1-3-9-17(13(4-2)11-16)21(18,19)15-10-12-7-5-6-8-14(12)20-15/h5-8,10,13H,3-4,9,11H2,1-2H3 |
| InChIKey | XWAYXNBHFUDFFZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|