C27H30O3 — CID 141094996
4-[(E)-4,6-bis(4-hydroxyphenyl)-7-methyloct-4-en-2-yl]phenol (PubChem CID 141094996) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is 4-[(E)-4,6-bis(4-hydroxyphenyl)-7-methyloct-4-en-2-yl]phenol.
| Compound Name | 4-[(E)-4,6-bis(4-hydroxyphenyl)-7-methyloct-4-en-2-yl]phenol |
|---|---|
| PubChem CID | 141094996 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 4-[(E)-4,6-bis(4-hydroxyphenyl)-7-methyloct-4-en-2-yl]phenol |
| SMILES | CC(C/C(=C\C(c1ccc(O)cc1)C(C)C)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H30O3/c1-18(2)27(22-8-14-26(30)15-9-22)17-23(21-6-12-25(29)13-7-21)16-19(3)20-4-10-24(28)11-5-20/h4-15,17-19,27-30H,16H2,1-3H3/b23-17+ |
| InChIKey | BRFUWPUQSVWPOH-HAVVHWLPSA-N |
| XLogP | 6.82 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |