C20H27N5O3 — CID 141095327
3-(3-tert-butylpyrazol-1-yl)-N,N-bis[2-(methylamino)-2-oxoethyl]benzamide (PubChem CID 141095327) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 3-(3-tert-butylpyrazol-1-yl)-N,N-bis[2-(methylamino)-2-oxoethyl]benzamide.
| Compound Name | 3-(3-tert-butylpyrazol-1-yl)-N,N-bis[2-(methylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 141095327 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 3-(3-tert-butylpyrazol-1-yl)-N,N-bis[2-(methylamino)-2-oxoethyl]benzamide |
| SMILES | CNC(=O)CN(CC(=O)NC)C(=O)c1cccc(-n2ccc(C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C20H27N5O3/c1-20(2,3)16-9-10-25(23-16)15-8-6-7-14(11-15)19(28)24(12-17(26)21-4)13-18(27)22-5/h6-11H,12-13H2,1-5H3,(H,21,26)(H,22,27) |
| InChIKey | CMBOWRVSSJFTAY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |