C15H17N3O2S — CID 141096412
2-[3-[benzyl(methyl)amino]-3-oxopropyl]-1,3-thiazole-5-carboxamide (PubChem CID 141096412) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-[3-[benzyl(methyl)amino]-3-oxopropyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[3-[benzyl(methyl)amino]-3-oxopropyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 141096412 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[3-[benzyl(methyl)amino]-3-oxopropyl]-1,3-thiazole-5-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)CCc1ncc(C(N)=O)s1 |
| InChI | InChI=1S/C15H17N3O2S/c1-18(10-11-5-3-2-4-6-11)14(19)8-7-13-17-9-12(21-13)15(16)20/h2-6,9H,7-8,10H2,1H3,(H2,16,20) |
| InChIKey | IVIOMIMSAWBCEW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |