About 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine
4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine (PubChem CID 141100116) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine |
| PubChem CID | 141100116 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1ncnc2c1CCN2CC1CCCO1 |
| InChI | InChI=1S/C12H17N3O/c1-9-11-4-5-15(12(11)14-8-13-9)7-10-3-2-6-16-10/h8,10H,2-7H2,1H3 |
| InChIKey | AGSLAXJWFPIJEC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine (CID 141100116) is 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine is Cc1ncnc2c1CCN2CC1CCCO1.
What is the InChIKey of 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine?
The InChIKey is AGSLAXJWFPIJEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-9-11-4-5-15(12(11)14-8-13-9)7-10-3-2-6-16-10/h8,10H,2-7H2,1H3.
What are the key properties of 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine?
4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine has a molecular weight of 219.29 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-7-(oxolan-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 141100116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).