About 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine
1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine (PubChem CID 114456219) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine.
Molecular Properties
| Compound Name | 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine |
| PubChem CID | 114456219 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(CC1CCCO1)CC2 |
| InChI | InChI=1S/C13H18N2O/c14-12-5-1-3-10-6-7-15(13(10)12)9-11-4-2-8-16-11/h1,3,5,11H,2,4,6-9,14H2 |
| InChIKey | OBHVZVKQTGSGRB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine?
The IUPAC name of 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine (CID 114456219) is 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine.
What is the SMILES notation for 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine?
The canonical SMILES for 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine is Nc1cccc2c1N(CC1CCCO1)CC2.
What is the InChIKey of 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine?
The InChIKey is OBHVZVKQTGSGRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c14-12-5-1-3-10-6-7-15(13(10)12)9-11-4-2-8-16-11/h1,3,5,11H,2,4,6-9,14H2.
What are the key properties of 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine?
1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine has a molecular weight of 218.30 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine is sourced from PubChem (CID 114456219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).