C13H18N2O — CID 114456219
1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine (PubChem CID 114456219) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine.
| Compound Name | 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114456219 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(CC1CCCO1)CC2 |
| InChI | InChI=1S/C13H18N2O/c14-12-5-1-3-10-6-7-15(13(10)12)9-11-4-2-8-16-11/h1,3,5,11H,2,4,6-9,14H2 |
| InChIKey | OBHVZVKQTGSGRB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|