C15H14F2N2 — CID 114930849
1-[(2,6-difluorophenyl)methyl]-2,3-dihydroindol-7-amine (PubChem CID 114930849) has the molecular formula C15H14F2N2 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-2,3-dihydroindol-7-amine.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114930849 |
| Molecular Formula | C15H14F2N2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(Cc1c(F)cccc1F)CC2 |
| InChI | InChI=1S/C15H14F2N2/c16-12-4-2-5-13(17)11(12)9-19-8-7-10-3-1-6-14(18)15(10)19/h1-6H,7-9,18H2 |
| InChIKey | CAUQAXVYGLESHW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|