C13H14F2N4 — CID 114456196
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2,3-dihydroindol-7-amine (PubChem CID 114456196) has the molecular formula C13H14F2N4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2,3-dihydroindol-7-amine.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114456196 |
| Molecular Formula | C13H14F2N4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(Cc1nccn1C(F)F)CC2 |
| InChI | InChI=1S/C13H14F2N4/c14-13(15)19-7-5-17-11(19)8-18-6-4-9-2-1-3-10(16)12(9)18/h1-3,5,7,13H,4,6,8,16H2 |
| InChIKey | IUGXVFKQDBOUCM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|