C14H14N4S — CID 114456501
1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2,3-dihydroindol-7-amine (PubChem CID 114456501) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2,3-dihydroindol-7-amine.
| Compound Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114456501 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(Cc1cn3ccsc3n1)CC2 |
| InChI | InChI=1S/C14H14N4S/c15-12-3-1-2-10-4-5-17(13(10)12)8-11-9-18-6-7-19-14(18)16-11/h1-3,6-7,9H,4-5,8,15H2 |
| InChIKey | UKBVFYVFZAXJSE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|