C13H13N3OS2 — CID 115335454
3-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfinyl)-2-methylaniline (PubChem CID 115335454) has the molecular formula C13H13N3OS2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfinyl)-2-methylaniline.
| Compound Name | 3-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfinyl)-2-methylaniline |
|---|---|
| PubChem CID | 115335454 |
| Molecular Formula | C13H13N3OS2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfinyl)-2-methylaniline |
| SMILES | Cc1c(N)cccc1S(=O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C13H13N3OS2/c1-9-11(14)3-2-4-12(9)19(17)8-10-7-16-5-6-18-13(16)15-10/h2-7H,8,14H2,1H3 |
| InChIKey | ZDSXDPLBMKFORG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|