C12H10FN3OS2 — CID 115335436
5-fluoro-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfinyl)aniline (PubChem CID 115335436) has the molecular formula C12H10FN3OS2 and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-fluoro-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfinyl)aniline.
| Compound Name | 5-fluoro-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfinyl)aniline |
|---|---|
| PubChem CID | 115335436 |
| Molecular Formula | C12H10FN3OS2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 5-fluoro-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfinyl)aniline |
| SMILES | Nc1cc(F)ccc1S(=O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C12H10FN3OS2/c13-8-1-2-11(10(14)5-8)19(17)7-9-6-16-3-4-18-12(16)15-9/h1-6H,7,14H2 |
| InChIKey | LCNYAVRAUUZHMS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|