C14H8FN3O2S — CID 78943007
5-fluoro-1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)indole-2,3-dione (PubChem CID 78943007) has the molecular formula C14H8FN3O2S and a molecular weight of 301.30 g/mol. Its IUPAC name is 5-fluoro-1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)indole-2,3-dione.
| Compound Name | 5-fluoro-1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 78943007 |
| Molecular Formula | C14H8FN3O2S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 5-fluoro-1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cn3ccsc3n2)c2ccc(F)cc21 |
| InChI | InChI=1S/C14H8FN3O2S/c15-8-1-2-11-10(5-8)12(19)13(20)18(11)7-9-6-17-3-4-21-14(17)16-9/h1-6H,7H2 |
| InChIKey | LNTINTGXAXIUDU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|