C15H13FN4O2S — CID 17411234
5-fluoro-N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)-2-methylbenzohydrazide (PubChem CID 17411234) has the molecular formula C15H13FN4O2S and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-fluoro-N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)-2-methylbenzohydrazide.
| Compound Name | 5-fluoro-N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 17411234 |
| Molecular Formula | C15H13FN4O2S |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 5-fluoro-N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)-2-methylbenzohydrazide |
| SMILES | Cc1ccc(F)cc1C(=O)NNC(=O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C15H13FN4O2S/c1-9-2-3-10(16)6-12(9)14(22)19-18-13(21)7-11-8-20-4-5-23-15(20)17-11/h2-6,8H,7H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | CGENKPKYBVGPMB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|