C13H10F2N4O3S2 — CID 8505191
N'-(2,4-difluorophenyl)sulfonyl-2-imidazo[2,1-b][1,3]thiazol-6-ylacetohydrazide (PubChem CID 8505191) has the molecular formula C13H10F2N4O3S2 and a molecular weight of 372.38 g/mol. Its IUPAC name is N'-(2,4-difluorophenyl)sulfonyl-2-imidazo[2,1-b][1,3]thiazol-6-ylacetohydrazide.
| Compound Name | N'-(2,4-difluorophenyl)sulfonyl-2-imidazo[2,1-b][1,3]thiazol-6-ylacetohydrazide |
|---|---|
| PubChem CID | 8505191 |
| Molecular Formula | C13H10F2N4O3S2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | N'-(2,4-difluorophenyl)sulfonyl-2-imidazo[2,1-b][1,3]thiazol-6-ylacetohydrazide |
| SMILES | O=C(Cc1cn2ccsc2n1)NNS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H10F2N4O3S2/c14-8-1-2-11(10(15)5-8)24(21,22)18-17-12(20)6-9-7-19-3-4-23-13(19)16-9/h1-5,7,18H,6H2,(H,17,20) |
| InChIKey | AOCXCULZRNBRFN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|