C15H13ClN4O2S — CID 27683802
2-(4-chlorophenyl)-N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)acetohydrazide (PubChem CID 27683802) has the molecular formula C15H13ClN4O2S and a molecular weight of 348.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)acetohydrazide.
| Compound Name | 2-(4-chlorophenyl)-N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)acetohydrazide |
|---|---|
| PubChem CID | 27683802 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)acetohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C15H13ClN4O2S/c16-11-3-1-10(2-4-11)7-13(21)18-19-14(22)8-12-9-20-5-6-23-15(20)17-12/h1-6,9H,7-8H2,(H,18,21)(H,19,22) |
| InChIKey | LOMIDTILWPMPMY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|