C15H14ClN3O2S — CID 31336221
N-[2-(4-chlorophenoxy)ethyl]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide (PubChem CID 31336221) has the molecular formula C15H14ClN3O2S and a molecular weight of 335.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
|---|---|
| PubChem CID | 31336221 |
| Molecular Formula | C15H14ClN3O2S |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
| SMILES | O=C(Cc1cn2ccsc2n1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClN3O2S/c16-11-1-3-13(4-2-11)21-7-5-17-14(20)9-12-10-19-6-8-22-15(19)18-12/h1-4,6,8,10H,5,7,9H2,(H,17,20) |
| InChIKey | MGTMFRXCIOVWGH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|