C12H14N6OS — CID 64546521
2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide (PubChem CID 64546521) has the molecular formula C12H14N6OS and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 64546521 |
| Molecular Formula | C12H14N6OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
| SMILES | O=C(Cc1cn2ccsc2n1)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H14N6OS/c19-11(13-3-1-2-10-14-8-15-17-10)6-9-7-18-4-5-20-12(18)16-9/h4-5,7-8H,1-3,6H2,(H,13,19)(H,14,15,17) |
| InChIKey | KZBBSBPOCJLTEH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|