C23H18N6O2S — CID 34299210
N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)-1,3-diphenylpyrazole-4-carbohydrazide (PubChem CID 34299210) has the molecular formula C23H18N6O2S and a molecular weight of 442.50 g/mol. Its IUPAC name is N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)-1,3-diphenylpyrazole-4-carbohydrazide.
| Compound Name | N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)-1,3-diphenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 34299210 |
| Molecular Formula | C23H18N6O2S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N'-(2-imidazo[2,1-b][1,3]thiazol-6-ylacetyl)-1,3-diphenylpyrazole-4-carbohydrazide |
| SMILES | O=C(Cc1cn2ccsc2n1)NNC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H18N6O2S/c30-20(13-17-14-28-11-12-32-23(28)24-17)25-26-22(31)19-15-29(18-9-5-2-6-10-18)27-21(19)16-7-3-1-4-8-16/h1-12,14-15H,13H2,(H,25,30)(H,26,31) |
| InChIKey | YQJVEKZHSXMMNE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|