C18H22N4O3S2 — CID 8505262
2-imidazo[2,1-b][1,3]thiazol-6-yl-N'-(2,3,4,5,6-pentamethylphenyl)sulfonylacetohydrazide (PubChem CID 8505262) has the molecular formula C18H22N4O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-N'-(2,3,4,5,6-pentamethylphenyl)sulfonylacetohydrazide.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N'-(2,3,4,5,6-pentamethylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8505262 |
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N'-(2,3,4,5,6-pentamethylphenyl)sulfonylacetohydrazide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NNC(=O)Cc2cn3ccsc3n2)c(C)c1C |
| InChI | InChI=1S/C18H22N4O3S2/c1-10-11(2)13(4)17(14(5)12(10)3)27(24,25)21-20-16(23)8-15-9-22-6-7-26-18(22)19-15/h6-7,9,21H,8H2,1-5H3,(H,20,23) |
| InChIKey | IWTZGASRCHDCJX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|