C14H13Cl2N3 — CID 106994975
1-[(2,6-dichloro-3-pyridinyl)methyl]-2,3-dihydroindol-7-amine (PubChem CID 106994975) has the molecular formula C14H13Cl2N3 and a molecular weight of 294.19 g/mol. Its IUPAC name is 1-[(2,6-dichloro-3-pyridinyl)methyl]-2,3-dihydroindol-7-amine.
| Compound Name | 1-[(2,6-dichloro-3-pyridinyl)methyl]-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 106994975 |
| Molecular Formula | C14H13Cl2N3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-[(2,6-dichloro-3-pyridinyl)methyl]-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(Cc1ccc(Cl)nc1Cl)CC2 |
| InChI | InChI=1S/C14H13Cl2N3/c15-12-5-4-10(14(16)18-12)8-19-7-6-9-2-1-3-11(17)13(9)19/h1-5H,6-8,17H2 |
| InChIKey | JIAWBTKPLBKPJJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|