C16H21ClN4 — CID 114456721
1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dihydroindol-7-amine (PubChem CID 114456721) has the molecular formula C16H21ClN4 and a molecular weight of 304.83 g/mol. Its IUPAC name is 1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dihydroindol-7-amine.
| Compound Name | 1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114456721 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.83 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dihydroindol-7-amine |
| SMILES | CCc1nn(CC)c(CN2CCc3cccc(N)c32)c1Cl |
| InChI | InChI=1S/C16H21ClN4/c1-3-13-15(17)14(21(4-2)19-13)10-20-9-8-11-6-5-7-12(18)16(11)20/h5-7H,3-4,8-10,18H2,1-2H3 |
| InChIKey | SBTKTRBFQZJCLZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.83 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|