C15H20ClN3S — CID 79142466
2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylsulfanyl]-4-methylaniline (PubChem CID 79142466) has the molecular formula C15H20ClN3S and a molecular weight of 309.87 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylsulfanyl]-4-methylaniline.
| Compound Name | 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylsulfanyl]-4-methylaniline |
|---|---|
| PubChem CID | 79142466 |
| Molecular Formula | C15H20ClN3S |
| Molecular Weight | 309.87 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methylsulfanyl]-4-methylaniline |
| SMILES | CCc1nn(CC)c(CSc2cc(C)ccc2N)c1Cl |
| InChI | InChI=1S/C15H20ClN3S/c1-4-12-15(16)13(19(5-2)18-12)9-20-14-8-10(3)6-7-11(14)17/h6-8H,4-5,9,17H2,1-3H3 |
| InChIKey | CZSSGFVNYBEHBN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|