C16H21ClN2O — CID 81005789
4-chloro-5-[(2,5-dimethylphenoxy)methyl]-1,3-diethylpyrazole (PubChem CID 81005789) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 4-chloro-5-[(2,5-dimethylphenoxy)methyl]-1,3-diethylpyrazole.
| Compound Name | 4-chloro-5-[(2,5-dimethylphenoxy)methyl]-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 81005789 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-chloro-5-[(2,5-dimethylphenoxy)methyl]-1,3-diethylpyrazole |
| SMILES | CCc1nn(CC)c(COc2cc(C)ccc2C)c1Cl |
| InChI | InChI=1S/C16H21ClN2O/c1-5-13-16(17)14(19(6-2)18-13)10-20-15-9-11(3)7-8-12(15)4/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | VFNXTCIUISMXOW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |