C14H16Cl3N3O — CID 107498514
4,5-dichloro-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methoxy]aniline (PubChem CID 107498514) has the molecular formula C14H16Cl3N3O and a molecular weight of 348.66 g/mol. Its IUPAC name is 4,5-dichloro-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methoxy]aniline.
| Compound Name | 4,5-dichloro-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methoxy]aniline |
|---|---|
| PubChem CID | 107498514 |
| Molecular Formula | C14H16Cl3N3O |
| Molecular Weight | 348.66 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 4,5-dichloro-2-[(4-chloro-1,3-diethylpyrazol-5-yl)methoxy]aniline |
| SMILES | CCc1nn(CC)c(COc2cc(Cl)c(Cl)cc2N)c1Cl |
| InChI | InChI=1S/C14H16Cl3N3O/c1-3-11-14(17)12(20(4-2)19-11)7-21-13-6-9(16)8(15)5-10(13)18/h5-6H,3-4,7,18H2,1-2H3 |
| InChIKey | LPESCBXFABTWJF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|