C26H33N5O2 — CID 141100285
2-ethyl-N-[2-(1H-imidazol-2-yl)-5-morpholin-4-ylphenyl]-3-(morpholin-4-ylmethyl)aniline (PubChem CID 141100285) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-ethyl-N-[2-(1H-imidazol-2-yl)-5-morpholin-4-ylphenyl]-3-(morpholin-4-ylmethyl)aniline.
| Compound Name | 2-ethyl-N-[2-(1H-imidazol-2-yl)-5-morpholin-4-ylphenyl]-3-(morpholin-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 141100285 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 2-ethyl-N-[2-(1H-imidazol-2-yl)-5-morpholin-4-ylphenyl]-3-(morpholin-4-ylmethyl)aniline |
| SMILES | CCc1c(CN2CCOCC2)cccc1Nc1cc(N2CCOCC2)ccc1-c1ncc[nH]1 |
| InChI | InChI=1S/C26H33N5O2/c1-2-22-20(19-30-10-14-32-15-11-30)4-3-5-24(22)29-25-18-21(31-12-16-33-17-13-31)6-7-23(25)26-27-8-9-28-26/h3-9,18,29H,2,10-17,19H2,1H3,(H,27,28) |
| InChIKey | XHOFFJRKFCEQPB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |