C27H30N6O3 — CID 90921465
N'-[2-ethyl-3-(morpholin-4-ylmethyl)phenyl]-2-(4-methoxyphenyl)-1H-imidazo[4,5-b]pyridine-6-carbohydrazide (PubChem CID 90921465) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is N'-[2-ethyl-3-(morpholin-4-ylmethyl)phenyl]-2-(4-methoxyphenyl)-1H-imidazo[4,5-b]pyridine-6-carbohydrazide.
| Compound Name | N'-[2-ethyl-3-(morpholin-4-ylmethyl)phenyl]-2-(4-methoxyphenyl)-1H-imidazo[4,5-b]pyridine-6-carbohydrazide |
|---|---|
| PubChem CID | 90921465 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | N'-[2-ethyl-3-(morpholin-4-ylmethyl)phenyl]-2-(4-methoxyphenyl)-1H-imidazo[4,5-b]pyridine-6-carbohydrazide |
| SMILES | CCc1c(CN2CCOCC2)cccc1NNC(=O)c1cnc2nc(-c3ccc(OC)cc3)[nH]c2c1 |
| InChI | InChI=1S/C27H30N6O3/c1-3-22-19(17-33-11-13-36-14-12-33)5-4-6-23(22)31-32-27(34)20-15-24-26(28-16-20)30-25(29-24)18-7-9-21(35-2)10-8-18/h4-10,15-16,31H,3,11-14,17H2,1-2H3,(H,32,34)(H,28,29,30) |
| InChIKey | LMLDBIHHBIDLTJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|