C13H13N3 — CID 141100567
6-pyrazol-1-yl-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 141100567) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 6-pyrazol-1-yl-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | 6-pyrazol-1-yl-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 141100567 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 6-pyrazol-1-yl-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | [H]/N=C1\CCCc2cc(-n3cccn3)ccc21 |
| InChI | InChI=1S/C13H13N3/c14-13-4-1-3-10-9-11(5-6-12(10)13)16-8-2-7-15-16/h2,5-9,14H,1,3-4H2/b14-13+ |
| InChIKey | IRFYJCLAFIHZMC-BUHFOSPRSA-N |
| XLogP | 2.58 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|