About 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium
1-methoxypropane-1-sulfonate;pyrrolidin-1-ium (PubChem CID 141103032) has the molecular formula C8H19NO4S
and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium.
Molecular Properties
| Compound Name | 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium |
| PubChem CID | 141103032 |
| Molecular Formula | C8H19NO4S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium |
| SMILES | C1CC[NH2+]C1.CCC(OC)S(=O)(=O)[O-] |
| InChI | InChI=1S/C4H9N.C4H10O4S/c1-2-4-5-3-1;1-3-4(8-2)9(5,6)7/h5H,1-4H2;4H,3H2,1-2H3,(H,5,6,7) |
| InChIKey | JAJLIOLLRNXCPG-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium?
The IUPAC name of 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium (CID 141103032) is 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium.
What is the SMILES notation for 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium?
The canonical SMILES for 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium is C1CC[NH2+]C1.CCC(OC)S(=O)(=O)[O-].
What is the InChIKey of 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium?
The InChIKey is JAJLIOLLRNXCPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.C4H10O4S/c1-2-4-5-3-1;1-3-4(8-2)9(5,6)7/h5H,1-4H2;4H,3H2,1-2H3,(H,5,6,7).
What are the key properties of 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium?
1-methoxypropane-1-sulfonate;pyrrolidin-1-ium has a molecular weight of 225.31 g/mol, XLogP of -0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropane-1-sulfonate;pyrrolidin-1-ium is sourced from PubChem (CID 141103032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).