About azanium pentan-3-yl sulfate
azanium pentan-3-yl sulfate (PubChem CID 141001545) has the molecular formula C5H15NO4S
and a molecular weight of 185.24 g/mol. Its IUPAC name is azanium pentan-3-yl sulfate.
Molecular Properties
| Compound Name | azanium pentan-3-yl sulfate |
| PubChem CID | 141001545 |
| Molecular Formula | C5H15NO4S |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | azanium pentan-3-yl sulfate |
| SMILES | CCC(CC)OS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C5H12O4S.H3N/c1-3-5(4-2)9-10(6,7)8;/h5H,3-4H2,1-2H3,(H,6,7,8);1H3 |
| InChIKey | YTDQCCBYUPJYRL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze azanium pentan-3-yl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium pentan-3-yl sulfate?
The IUPAC name of azanium pentan-3-yl sulfate (CID 141001545) is azanium pentan-3-yl sulfate.
What is the SMILES notation for azanium pentan-3-yl sulfate?
The canonical SMILES for azanium pentan-3-yl sulfate is CCC(CC)OS(=O)(=O)[O-].[NH4+].
What is the InChIKey of azanium pentan-3-yl sulfate?
The InChIKey is YTDQCCBYUPJYRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O4S.H3N/c1-3-5(4-2)9-10(6,7)8;/h5H,3-4H2,1-2H3,(H,6,7,8);1H3.
What are the key properties of azanium pentan-3-yl sulfate?
azanium pentan-3-yl sulfate has a molecular weight of 185.24 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium pentan-3-yl sulfate is sourced from PubChem (CID 141001545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).