About sodium [(3S)-hept-4-yn-3-yl] sulfate
sodium [(3S)-hept-4-yn-3-yl] sulfate (PubChem CID 135075296) has the molecular formula C7H11NaO4S
and a molecular weight of 214.22 g/mol. Its IUPAC name is sodium [(3S)-hept-4-yn-3-yl] sulfate.
Molecular Properties
| Compound Name | sodium [(3S)-hept-4-yn-3-yl] sulfate |
| PubChem CID | 135075296 |
| Molecular Formula | C7H11NaO4S |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | sodium [(3S)-hept-4-yn-3-yl] sulfate |
| SMILES | CCC#C[C@H](CC)OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H12O4S.Na/c1-3-5-6-7(4-2)11-12(8,9)10;/h7H,3-4H2,1-2H3,(H,8,9,10);/q;+1/p-1/t7-;/m0./s1 |
| InChIKey | DMQNEIBWSOUJOU-FJXQXJEOSA-M |
| XLogP | -2.34 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium [(3S)-hept-4-yn-3-yl] sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium [(3S)-hept-4-yn-3-yl] sulfate?
The IUPAC name of sodium [(3S)-hept-4-yn-3-yl] sulfate (CID 135075296) is sodium [(3S)-hept-4-yn-3-yl] sulfate.
What is the SMILES notation for sodium [(3S)-hept-4-yn-3-yl] sulfate?
The canonical SMILES for sodium [(3S)-hept-4-yn-3-yl] sulfate is CCC#C[C@H](CC)OS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium [(3S)-hept-4-yn-3-yl] sulfate?
The InChIKey is DMQNEIBWSOUJOU-FJXQXJEOSA-M. The full InChI is InChI=1S/C7H12O4S.Na/c1-3-5-6-7(4-2)11-12(8,9)10;/h7H,3-4H2,1-2H3,(H,8,9,10);/q;+1/p-1/t7-;/m0./s1.
What are the key properties of sodium [(3S)-hept-4-yn-3-yl] sulfate?
sodium [(3S)-hept-4-yn-3-yl] sulfate has a molecular weight of 214.22 g/mol, XLogP of -2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [(3S)-hept-4-yn-3-yl] sulfate is sourced from PubChem (CID 135075296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).