C17H29NO — CID 141103685
4-[2-(1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)propyl]morpholine (PubChem CID 141103685) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 4-[2-(1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)propyl]morpholine.
| Compound Name | 4-[2-(1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)propyl]morpholine |
|---|---|
| PubChem CID | 141103685 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4-[2-(1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)propyl]morpholine |
| SMILES | CC(CN1CCOCC1)C1CC=CC2CCCCC21 |
| InChI | InChI=1S/C17H29NO/c1-14(13-18-9-11-19-12-10-18)16-8-4-6-15-5-2-3-7-17(15)16/h4,6,14-17H,2-3,5,7-13H2,1H3 |
| InChIKey | RFMKUKLAATXGDZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|