C10H6Cl2OS — CID 141104208
1-(1-benzothiophen-2-yl)-2,2-dichloroethanone (PubChem CID 141104208) has the molecular formula C10H6Cl2OS and a molecular weight of 245.13 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-2,2-dichloroethanone.
| Compound Name | 1-(1-benzothiophen-2-yl)-2,2-dichloroethanone |
|---|---|
| PubChem CID | 141104208 |
| Molecular Formula | C10H6Cl2OS |
| Molecular Weight | 245.13 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-2,2-dichloroethanone |
| SMILES | O=C(c1cc2ccccc2s1)C(Cl)Cl |
| InChI | InChI=1S/C10H6Cl2OS/c11-10(12)9(13)8-5-6-3-1-2-4-7(6)14-8/h1-5,10H |
| InChIKey | AWNRLWAGJMINLW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|