C7H10N2O — CID 141104267
(4-prop-1-enyl-1,3-oxazol-2-yl)methanamine (PubChem CID 141104267) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is (4-prop-1-enyl-1,3-oxazol-2-yl)methanamine.
| Compound Name | (4-prop-1-enyl-1,3-oxazol-2-yl)methanamine |
|---|---|
| PubChem CID | 141104267 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (4-prop-1-enyl-1,3-oxazol-2-yl)methanamine |
| SMILES | CC=Cc1coc(CN)n1 |
| InChI | InChI=1S/C7H10N2O/c1-2-3-6-5-10-7(4-8)9-6/h2-3,5H,4,8H2,1H3 |
| InChIKey | HBJPTXKFUMIRRF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |