C5H8N2OS — CID 117186769
2-(methylsulfanylmethyl)-1,3-oxazol-4-amine (PubChem CID 117186769) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is 2-(methylsulfanylmethyl)-1,3-oxazol-4-amine.
| Compound Name | 2-(methylsulfanylmethyl)-1,3-oxazol-4-amine |
|---|---|
| PubChem CID | 117186769 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 2-(methylsulfanylmethyl)-1,3-oxazol-4-amine |
| SMILES | CSCc1nc(N)co1 |
| InChI | InChI=1S/C5H8N2OS/c1-9-3-5-7-4(6)2-8-5/h2H,3,6H2,1H3 |
| InChIKey | AWJDYXXZOSVFTA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |