C7H12N2OS — CID 117191016
4-(propan-2-ylsulfanylmethyl)-1,3-oxazol-2-amine (PubChem CID 117191016) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is 4-(propan-2-ylsulfanylmethyl)-1,3-oxazol-2-amine.
| Compound Name | 4-(propan-2-ylsulfanylmethyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 117191016 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4-(propan-2-ylsulfanylmethyl)-1,3-oxazol-2-amine |
| SMILES | CC(C)SCc1coc(N)n1 |
| InChI | InChI=1S/C7H12N2OS/c1-5(2)11-4-6-3-10-7(8)9-6/h3,5H,4H2,1-2H3,(H2,8,9) |
| InChIKey | RRCXOCPDKXIYLX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |