C4H6N2OS — CID 117188944
2-methylsulfanyl-1,3-oxazol-4-amine (PubChem CID 117188944) has the molecular formula C4H6N2OS and a molecular weight of 130.17 g/mol. Its IUPAC name is 2-methylsulfanyl-1,3-oxazol-4-amine.
| Compound Name | 2-methylsulfanyl-1,3-oxazol-4-amine |
|---|---|
| PubChem CID | 117188944 |
| Molecular Formula | C4H6N2OS |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | 2-methylsulfanyl-1,3-oxazol-4-amine |
| SMILES | CSc1nc(N)co1 |
| InChI | InChI=1S/C4H6N2OS/c1-8-4-6-3(5)2-7-4/h2H,5H2,1H3 |
| InChIKey | ODATWCZKOVFMBR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |