C4H6N2OS — CID 117186793
(4-amino-1,3-oxazol-2-yl)methanethiol (PubChem CID 117186793) has the molecular formula C4H6N2OS and a molecular weight of 130.17 g/mol. Its IUPAC name is (4-amino-1,3-oxazol-2-yl)methanethiol.
| Compound Name | (4-amino-1,3-oxazol-2-yl)methanethiol |
|---|---|
| PubChem CID | 117186793 |
| Molecular Formula | C4H6N2OS |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | (4-amino-1,3-oxazol-2-yl)methanethiol |
| SMILES | Nc1coc(CS)n1 |
| InChI | InChI=1S/C4H6N2OS/c5-3-1-7-4(2-8)6-3/h1,8H,2,5H2 |
| InChIKey | VQJYKDNYGPKWDI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|