C9H16N2O — CID 115084229
3-(2-propyl-1,3-oxazol-4-yl)propan-1-amine (PubChem CID 115084229) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-(2-propyl-1,3-oxazol-4-yl)propan-1-amine.
| Compound Name | 3-(2-propyl-1,3-oxazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 115084229 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 3-(2-propyl-1,3-oxazol-4-yl)propan-1-amine |
| SMILES | CCCc1nc(CCCN)co1 |
| InChI | InChI=1S/C9H16N2O/c1-2-4-9-11-8(7-12-9)5-3-6-10/h7H,2-6,10H2,1H3 |
| InChIKey | IBJNIAUHTPYWOH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |