C19H32O3 — CID 141105209
(13Z)-3,3,4,4-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 141105209) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (13Z)-3,3,4,4-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13Z)-3,3,4,4-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 141105209 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (13Z)-3,3,4,4-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1(C)CC(=O)CCCCCC/C=C\CCOC(=O)C1(C)C |
| InChI | InChI=1S/C19H32O3/c1-18(2)15-16(20)13-11-9-7-5-6-8-10-12-14-22-17(21)19(18,3)4/h8,10H,5-7,9,11-15H2,1-4H3/b10-8- |
| InChIKey | KRIDVQWHLSDXAD-NTMALXAHSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|