C12H11FN2O3S — CID 141105687
4-(2-fluoro-4-methylsulfonylphenoxy)-5-methylpyrimidine (PubChem CID 141105687) has the molecular formula C12H11FN2O3S and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-(2-fluoro-4-methylsulfonylphenoxy)-5-methylpyrimidine.
| Compound Name | 4-(2-fluoro-4-methylsulfonylphenoxy)-5-methylpyrimidine |
|---|---|
| PubChem CID | 141105687 |
| Molecular Formula | C12H11FN2O3S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 4-(2-fluoro-4-methylsulfonylphenoxy)-5-methylpyrimidine |
| SMILES | Cc1cncnc1Oc1ccc(S(C)(=O)=O)cc1F |
| InChI | InChI=1S/C12H11FN2O3S/c1-8-6-14-7-15-12(8)18-11-4-3-9(5-10(11)13)19(2,16)17/h3-7H,1-2H3 |
| InChIKey | WOBDGVGCUXOCAP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |