C10H22O9 — CID 141107070
decane-1,1,1,2,2,3,3,4,4-nonol (PubChem CID 141107070) has the molecular formula C10H22O9 and a molecular weight of 286.28 g/mol. Its IUPAC name is decane-1,1,1,2,2,3,3,4,4-nonol.
| Compound Name | decane-1,1,1,2,2,3,3,4,4-nonol |
|---|---|
| PubChem CID | 141107070 |
| Molecular Formula | C10H22O9 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | decane-1,1,1,2,2,3,3,4,4-nonol |
| SMILES | CCCCCCC(O)(O)C(O)(O)C(O)(O)C(O)(O)O |
| InChI | InChI=1S/C10H22O9/c1-2-3-4-5-6-7(11,12)8(13,14)9(15,16)10(17,18)19/h11-19H,2-6H2,1H3 |
| InChIKey | SXSIUBPHJTYXHK-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|